The preferred IUPAC name is the systematic name 2-methylbutane. An isopentyl group is a subset of the generic pentyl group. It has the chemical structure -CH3CH2CH(CH3)2.
What is the common name for 2 methyl butane?
Isopentane
| PubChem CID | 6556 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C5H12 or (CH3)2-CH-CH2-CH3 |
| Synonyms | 2-Methylbutane ISOPENTANE 78-78-4 Isoamylhydride Butane, 2-methyl- More… |
What is the structure of 2 Methyl 1 Bromo butane?
(S)-1-Bromo-2-methylbutane
| PubChem CID | 5464167 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C5H11Br |
| Synonyms | (S)-1-Bromo-2-methylbutane 534-00-9 (S)-(+)-1-Bromo-2-methylbutane (2S)-1-bromo-2-methylbutane Butane, 1-bromo-2-methyl-, (2S)- More… |
What is the common name of 1 bromo 2 methyl butane?
1-Bromo-2-methylbutane – Names and Identifiers
| Name | 1-Bromo-2-methylbutane |
|---|---|
| Synonyms | Butane, 1-bromo-2-methyl- (1)-1-Bromo-2-methylbutane 2-Methylbutyl Bromide 2-Methyl Bromobutane |
| CAS | 5973-11-5 10422-35-2 |
| EINECS | 227-768-1 |
| InChI | InChI=1/C5H11Br/c1-3-5(2)4-6/h5H,3-4H2,1-2H3 |
What is the structural formula of 2 methyl propane?
C4H10Isobutane / Formula
Isobutane or 2-Methylpropane, also known as (CH3)2ch-CH3, belongs to the class of organic compounds known as branched alkanes. These are acyclic branched hydrocarbons having the general formula CnH2n+2. It is a chemical compound with molecular formula HC(CH3)3. It is an isomer of butane.
What is the molar mass of 2-methylbutane?
72.15 g/molIsopentane / Molar mass
What is the molar mass of 2 Bromo 2 Methylbutane?
151.04
2-Bromo-2-methylbutane
| PubChem CID | 68180 |
|---|---|
| Molecular Formula | C5H11Br |
| Synonyms | 2-Bromo-2-methylbutane 507-36-8 tert-Amyl bromide Butane, 2-bromo-2-methyl- tert-Pentyl bromide More… |
| Molecular Weight | 151.04 |
| Dates | Modify 2022-01-15 Create 2005-03-26 |
What is the molar mass of 2 Bromo 2-methylbutane?
What is the common name of 1-bromo-2 Methylpropane?
tert-Butyl bromide
| Names |
|---|
| Preferred IUPAC name 2-Bromo-2-methylpropane |
| Other names 1-Bromo-1,1-dimethylethane Bromotrimethylmethane 1,1-Dimethylethyl bromide Trimethylbromomethane |
| Identifiers |
| CAS Number |
